C11H18ClN3OS — CID 140594840
2-amino-5-chloro-3-(1,3-thiazolidin-2-yl)-3a,4,5,6,7,7a-hexahydroindol-3-ol (PubChem CID 140594840) has the molecular formula C11H18ClN3OS and a molecular weight of 275.81 g/mol. Its IUPAC name is 2-amino-5-chloro-3-(1,3-thiazolidin-2-yl)-3a,4,5,6,7,7a-hexahydroindol-3-ol.
| Compound Name | 2-amino-5-chloro-3-(1,3-thiazolidin-2-yl)-3a,4,5,6,7,7a-hexahydroindol-3-ol |
|---|---|
| PubChem CID | 140594840 |
| Molecular Formula | C11H18ClN3OS |
| Molecular Weight | 275.81 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-amino-5-chloro-3-(1,3-thiazolidin-2-yl)-3a,4,5,6,7,7a-hexahydroindol-3-ol |
| SMILES | NC1=NC2CCC(Cl)CC2C1(O)C1NCCS1 |
| InChI | InChI=1S/C11H18ClN3OS/c12-6-1-2-8-7(5-6)11(16,9(13)15-8)10-14-3-4-17-10/h6-8,10,14,16H,1-5H2,(H2,13,15) |
| InChIKey | WSDJDDKEJXIYLS-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.81 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|