C16H27ClN2O3 — CID 140594930
2-amino-5-chloro-3-(2,4-dimethoxycyclohexyl)-3a,4,5,6,7,7a-hexahydroindol-3-ol (PubChem CID 140594930) has the molecular formula C16H27ClN2O3 and a molecular weight of 330.86 g/mol. Its IUPAC name is 2-amino-5-chloro-3-(2,4-dimethoxycyclohexyl)-3a,4,5,6,7,7a-hexahydroindol-3-ol.
| Compound Name | 2-amino-5-chloro-3-(2,4-dimethoxycyclohexyl)-3a,4,5,6,7,7a-hexahydroindol-3-ol |
|---|---|
| PubChem CID | 140594930 |
| Molecular Formula | C16H27ClN2O3 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 2-amino-5-chloro-3-(2,4-dimethoxycyclohexyl)-3a,4,5,6,7,7a-hexahydroindol-3-ol |
| SMILES | COC1CCC(C2(O)C(N)=NC3CCC(Cl)CC32)C(OC)C1 |
| InChI | InChI=1S/C16H27ClN2O3/c1-21-10-4-5-11(14(8-10)22-2)16(20)12-7-9(17)3-6-13(12)19-15(16)18/h9-14,20H,3-8H2,1-2H3,(H2,18,19) |
| InChIKey | CCXTWUKOFNGOQZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|