C15H25Cl2N3O2 — CID 140594763
2-amino-5-chloro-3-(5-chloro-2-ethoxypiperidin-4-yl)-3a,4,5,6,7,7a-hexahydroindol-3-ol (PubChem CID 140594763) has the molecular formula C15H25Cl2N3O2 and a molecular weight of 350.29 g/mol. Its IUPAC name is 2-amino-5-chloro-3-(5-chloro-2-ethoxypiperidin-4-yl)-3a,4,5,6,7,7a-hexahydroindol-3-ol.
| Compound Name | 2-amino-5-chloro-3-(5-chloro-2-ethoxypiperidin-4-yl)-3a,4,5,6,7,7a-hexahydroindol-3-ol |
|---|---|
| PubChem CID | 140594763 |
| Molecular Formula | C15H25Cl2N3O2 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2-amino-5-chloro-3-(5-chloro-2-ethoxypiperidin-4-yl)-3a,4,5,6,7,7a-hexahydroindol-3-ol |
| SMILES | CCOC1CC(C2(O)C(N)=NC3CCC(Cl)CC32)C(Cl)CN1 |
| InChI | InChI=1S/C15H25Cl2N3O2/c1-2-22-13-6-9(11(17)7-19-13)15(21)10-5-8(16)3-4-12(10)20-14(15)18/h8-13,19,21H,2-7H2,1H3,(H2,18,20) |
| InChIKey | UEAMQOJLZAWEPT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|