C48H36LiN4O+ — CID 140600500
lithium 5-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-11,11,12,12-tetramethylindeno[2,1-a]fluoren-9-yl]quinolin-1-ium-8-olate (PubChem CID 140600500) has the molecular formula C48H36LiN4O+ and a molecular weight of 691.78 g/mol. Its IUPAC name is lithium 5-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-11,11,12,12-tetramethylindeno[2,1-a]fluoren-9-yl]quinolin-1-ium-8-olate.
| Compound Name | lithium 5-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-11,11,12,12-tetramethylindeno[2,1-a]fluoren-9-yl]quinolin-1-ium-8-olate |
|---|---|
| PubChem CID | 140600500 |
| Molecular Formula | C48H36LiN4O+ |
| Molecular Weight | 691.78 g/mol |
| Exact Mass | 691.30 |
| IUPAC Name | lithium 5-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-11,11,12,12-tetramethylindeno[2,1-a]fluoren-9-yl]quinolin-1-ium-8-olate |
| SMILES | CC1(C)c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc2-c2ccc3c(c21)C(C)(C)c1cc(-c2ccc([O-])c4[nH+]cccc24)ccc1-3.[Li+] |
| InChI | InChI=1S/C48H36N4O.Li/c1-47(2)38-26-30(32-23-24-40(53)43-37(32)16-11-25-49-43)17-19-33(38)35-21-22-36-34-20-18-31(27-39(34)48(3,4)42(36)41(35)47)46-51-44(28-12-7-5-8-13-28)50-45(52-46)29-14-9-6-10-15-29;/h5-27,53H,1-4H3;/q;+1 |
| InChIKey | YSUAXCMBJWQUJZ-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.78 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |