C25H29N7O5S2 — CID 140603518
1-[N-(benzenesulfonyl)-4-sulfamoylanilino]-3-[3-[(2-imino-4-methylpiperazin-1-yl)methyl]phenyl]urea (PubChem CID 140603518) has the molecular formula C25H29N7O5S2 and a molecular weight of 571.69 g/mol. Its IUPAC name is 1-[N-(benzenesulfonyl)-4-sulfamoylanilino]-3-[3-[(2-imino-4-methylpiperazin-1-yl)methyl]phenyl]urea.
| Compound Name | 1-[N-(benzenesulfonyl)-4-sulfamoylanilino]-3-[3-[(2-imino-4-methylpiperazin-1-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 140603518 |
| Molecular Formula | C25H29N7O5S2 |
| Molecular Weight | 571.69 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | 1-[N-(benzenesulfonyl)-4-sulfamoylanilino]-3-[3-[(2-imino-4-methylpiperazin-1-yl)methyl]phenyl]urea |
| SMILES | [H]/N=C1\CN(C)CCN1Cc1cccc(NC(=O)NN(c2ccc(S(N)(=O)=O)cc2)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C25H29N7O5S2/c1-30-14-15-31(24(26)18-30)17-19-6-5-7-20(16-19)28-25(33)29-32(39(36,37)23-8-3-2-4-9-23)21-10-12-22(13-11-21)38(27,34)35/h2-13,16,26H,14-15,17-18H2,1H3,(H2,27,34,35)(H2,28,29,33)/b26-24+ |
| InChIKey | SKTJMNXMHJOHLH-SHHOIMCASA-N |
| XLogP | 1.99 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.69 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|