C13H15N — CID 140604704
(1R)-N-methyl-1-prop-2-ynyl-2,3-dihydroinden-1-amine (PubChem CID 140604704) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is (1R)-N-methyl-1-prop-2-ynyl-2,3-dihydroinden-1-amine.
| Compound Name | (1R)-N-methyl-1-prop-2-ynyl-2,3-dihydroinden-1-amine |
|---|---|
| PubChem CID | 140604704 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (1R)-N-methyl-1-prop-2-ynyl-2,3-dihydroinden-1-amine |
| SMILES | C#CC[C@]1(NC)CCc2ccccc21 |
| InChI | InChI=1S/C13H15N/c1-3-9-13(14-2)10-8-11-6-4-5-7-12(11)13/h1,4-7,14H,8-10H2,2H3/t13-/m0/s1 |
| InChIKey | SQGPJNRKLZOTMK-ZDUSSCGKSA-N |
| XLogP | 2.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|