C11H20O4S2+2 — CID 140613417
[5-(2-dimethylsulfonioethyl)-3,6-dioxo-1,4-dioxan-2-yl]methyl-dimethylsulfanium (PubChem CID 140613417) has the molecular formula C11H20O4S2+2 and a molecular weight of 280.41 g/mol. Its IUPAC name is [5-(2-dimethylsulfonioethyl)-3,6-dioxo-1,4-dioxan-2-yl]methyl-dimethylsulfanium.
| Compound Name | [5-(2-dimethylsulfonioethyl)-3,6-dioxo-1,4-dioxan-2-yl]methyl-dimethylsulfanium |
|---|---|
| PubChem CID | 140613417 |
| Molecular Formula | C11H20O4S2+2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | [5-(2-dimethylsulfonioethyl)-3,6-dioxo-1,4-dioxan-2-yl]methyl-dimethylsulfanium |
| SMILES | C[S+](C)CCC1OC(=O)C(C[S+](C)C)OC1=O |
| InChI | InChI=1S/C11H20O4S2/c1-16(2)6-5-8-10(12)15-9(7-17(3)4)11(13)14-8/h8-9H,5-7H2,1-4H3/q+2 |
| InChIKey | HLRLYMZASVRMTI-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|