C7H10O6 — CID 140615515
1,2,3,3-tetrahydroxyprop-2-enyl 2-methylprop-2-enoate (PubChem CID 140615515) has the molecular formula C7H10O6 and a molecular weight of 190.15 g/mol. Its IUPAC name is 1,2,3,3-tetrahydroxyprop-2-enyl 2-methylprop-2-enoate.
| Compound Name | 1,2,3,3-tetrahydroxyprop-2-enyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140615515 |
| Molecular Formula | C7H10O6 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 1,2,3,3-tetrahydroxyprop-2-enyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(O)C(O)=C(O)O |
| InChI | InChI=1S/C7H10O6/c1-3(2)6(11)13-7(12)4(8)5(9)10/h7-10,12H,1H2,2H3 |
| InChIKey | RHLBNNUVSKKJQT-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|