C30H57N5Si2 — CID 140624817
N,N-bis[tris(2-methylpropyl)silyl]pteridin-7-amine (PubChem CID 140624817) has the molecular formula C30H57N5Si2 and a molecular weight of 543.99 g/mol. Its IUPAC name is N,N-bis[tris(2-methylpropyl)silyl]pteridin-7-amine.
| Compound Name | N,N-bis[tris(2-methylpropyl)silyl]pteridin-7-amine |
|---|---|
| PubChem CID | 140624817 |
| Molecular Formula | C30H57N5Si2 |
| Molecular Weight | 543.99 g/mol |
| Exact Mass | 543.42 |
| IUPAC Name | N,N-bis[tris(2-methylpropyl)silyl]pteridin-7-amine |
| SMILES | CC(C)C[Si](CC(C)C)(CC(C)C)N(c1cnc2cncnc2n1)[Si](CC(C)C)(CC(C)C)CC(C)C |
| InChI | InChI=1S/C30H57N5Si2/c1-22(2)15-36(16-23(3)4,17-24(5)6)35(29-14-32-28-13-31-21-33-30(28)34-29)37(18-25(7)8,19-26(9)10)20-27(11)12/h13-14,21-27H,15-20H2,1-12H3 |
| InChIKey | JDLWKADOSXWRIN-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.99 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|