C17H16ClN7 — CID 140626230
5-[2-[(2-chloro-4-pyridinyl)amino]pyrimidin-4-yl]-4-(cyclopropylmethyl)pyrimidin-2-amine (PubChem CID 140626230) has the molecular formula C17H16ClN7 and a molecular weight of 353.82 g/mol. Its IUPAC name is 5-[2-[(2-chloro-4-pyridinyl)amino]pyrimidin-4-yl]-4-(cyclopropylmethyl)pyrimidin-2-amine.
| Compound Name | 5-[2-[(2-chloro-4-pyridinyl)amino]pyrimidin-4-yl]-4-(cyclopropylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 140626230 |
| Molecular Formula | C17H16ClN7 |
| Molecular Weight | 353.82 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 5-[2-[(2-chloro-4-pyridinyl)amino]pyrimidin-4-yl]-4-(cyclopropylmethyl)pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2ccnc(Nc3ccnc(Cl)c3)n2)c(CC2CC2)n1 |
| InChI | InChI=1S/C17H16ClN7/c18-15-8-11(3-5-20-15)23-17-21-6-4-13(25-17)12-9-22-16(19)24-14(12)7-10-1-2-10/h3-6,8-10H,1-2,7H2,(H2,19,22,24)(H,20,21,23,25) |
| InChIKey | QELFYJUUCOBXNE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.82 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|