C10H14N2Na2O8S2 — CID 140628315
disodium;2-[1-(hydroxyamino)ethyl]-5-(methoxymethylamino)benzene-1,4-disulfonate (PubChem CID 140628315) has the molecular formula C10H14N2Na2O8S2 and a molecular weight of 400.34 g/mol. Its IUPAC name is disodium;2-[1-(hydroxyamino)ethyl]-5-(methoxymethylamino)benzene-1,4-disulfonate.
| Compound Name | disodium;2-[1-(hydroxyamino)ethyl]-5-(methoxymethylamino)benzene-1,4-disulfonate |
|---|---|
| PubChem CID | 140628315 |
| Molecular Formula | C10H14N2Na2O8S2 |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | disodium;2-[1-(hydroxyamino)ethyl]-5-(methoxymethylamino)benzene-1,4-disulfonate |
| SMILES | COCNc1cc(S(=O)(=O)[O-])c(C(C)NO)cc1S(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C10H16N2O8S2.2Na/c1-6(12-13)7-3-10(22(17,18)19)8(11-5-20-2)4-9(7)21(14,15)16;;/h3-4,6,11-13H,5H2,1-2H3,(H,14,15,16)(H,17,18,19);;/q;2*+1/p-2 |
| InChIKey | FGEQSYDEVFRZMF-UHFFFAOYSA-L |
| XLogP | -6.44 |
| TPSA | 167.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | -6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|