C20H30NO7S- — CID 140635644
2-benzamido-4-[2-hydroxy-3-(2-hydroxy-3-propan-2-yloxypropoxy)propyl]sulfanylbutanoate (PubChem CID 140635644) has the molecular formula C20H30NO7S- and a molecular weight of 428.53 g/mol. Its IUPAC name is 2-benzamido-4-[2-hydroxy-3-(2-hydroxy-3-propan-2-yloxypropoxy)propyl]sulfanylbutanoate.
| Compound Name | 2-benzamido-4-[2-hydroxy-3-(2-hydroxy-3-propan-2-yloxypropoxy)propyl]sulfanylbutanoate |
|---|---|
| PubChem CID | 140635644 |
| Molecular Formula | C20H30NO7S- |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 2-benzamido-4-[2-hydroxy-3-(2-hydroxy-3-propan-2-yloxypropoxy)propyl]sulfanylbutanoate |
| SMILES | CC(C)OCC(O)COCC(O)CSCCC(NC(=O)c1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C20H31NO7S/c1-14(2)28-12-16(22)10-27-11-17(23)13-29-9-8-18(20(25)26)21-19(24)15-6-4-3-5-7-15/h3-7,14,16-18,22-23H,8-13H2,1-2H3,(H,21,24)(H,25,26)/p-1 |
| InChIKey | DEKFFCAVIFJUFM-UHFFFAOYSA-M |
| XLogP | -0.18 |
| TPSA | 128.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|