C18H27NO6 — CID 140636855
methoxymethyl N-[2-tert-butyl-3-hydroxy-1-(methoxymethoxy)-2,3-dihydroinden-1-yl]carbamate (PubChem CID 140636855) has the molecular formula C18H27NO6 and a molecular weight of 353.42 g/mol. Its IUPAC name is methoxymethyl N-[2-tert-butyl-3-hydroxy-1-(methoxymethoxy)-2,3-dihydroinden-1-yl]carbamate.
| Compound Name | methoxymethyl N-[2-tert-butyl-3-hydroxy-1-(methoxymethoxy)-2,3-dihydroinden-1-yl]carbamate |
|---|---|
| PubChem CID | 140636855 |
| Molecular Formula | C18H27NO6 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | methoxymethyl N-[2-tert-butyl-3-hydroxy-1-(methoxymethoxy)-2,3-dihydroinden-1-yl]carbamate |
| SMILES | COCOC(=O)NC1(OCOC)c2ccccc2C(O)C1C(C)(C)C |
| InChI | InChI=1S/C18H27NO6/c1-17(2,3)15-14(20)12-8-6-7-9-13(12)18(15,25-11-23-5)19-16(21)24-10-22-4/h6-9,14-15,20H,10-11H2,1-5H3,(H,19,21) |
| InChIKey | RNNJJBTXTSNQOJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|