C17H29NO4Si — CID 159643808
methane;2-trimethylsilylethyl N-[(1R,2R,3R)-2,3-dihydroxy-1-methyl-2,3-dihydroinden-1-yl]carbamate (PubChem CID 159643808) has the molecular formula C17H29NO4Si and a molecular weight of 339.51 g/mol. Its IUPAC name is methane;2-trimethylsilylethyl N-[(1R,2R,3R)-2,3-dihydroxy-1-methyl-2,3-dihydroinden-1-yl]carbamate.
| Compound Name | methane;2-trimethylsilylethyl N-[(1R,2R,3R)-2,3-dihydroxy-1-methyl-2,3-dihydroinden-1-yl]carbamate |
|---|---|
| PubChem CID | 159643808 |
| Molecular Formula | C17H29NO4Si |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | methane;2-trimethylsilylethyl N-[(1R,2R,3R)-2,3-dihydroxy-1-methyl-2,3-dihydroinden-1-yl]carbamate |
| SMILES | C.C[C@@]1(NC(=O)OCC[Si](C)(C)C)c2ccccc2[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H25NO4Si.CH4/c1-16(17-15(20)21-9-10-22(2,3)4)12-8-6-5-7-11(12)13(18)14(16)19;/h5-8,13-14,18-19H,9-10H2,1-4H3,(H,17,20);1H4/t13-,14+,16-;/m1./s1 |
| InChIKey | MQRSRIYEQFZXFW-CFDZSLPFSA-N |
| XLogP | 3.01 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|