C12H19N2NaO4 — CID 140642395
sodium 2,3-dimethyl-4-[2-(2-methylprop-2-enoylamino)ethylamino]-4-oxobutanoate (PubChem CID 140642395) has the molecular formula C12H19N2NaO4 and a molecular weight of 278.28 g/mol. Its IUPAC name is sodium 2,3-dimethyl-4-[2-(2-methylprop-2-enoylamino)ethylamino]-4-oxobutanoate.
| Compound Name | sodium 2,3-dimethyl-4-[2-(2-methylprop-2-enoylamino)ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 140642395 |
| Molecular Formula | C12H19N2NaO4 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | sodium 2,3-dimethyl-4-[2-(2-methylprop-2-enoylamino)ethylamino]-4-oxobutanoate |
| SMILES | C=C(C)C(=O)NCCNC(=O)C(C)C(C)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C12H20N2O4.Na/c1-7(2)10(15)13-5-6-14-11(16)8(3)9(4)12(17)18;/h8-9H,1,5-6H2,2-4H3,(H,13,15)(H,14,16)(H,17,18);/q;+1/p-1 |
| InChIKey | CCTWAWJYCOSAJG-UHFFFAOYSA-M |
| XLogP | -4.18 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | -4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|