About benzyl(diiodo)-λ3-iodane
benzyl(diiodo)-λ3-iodane (PubChem CID 140643667) has the molecular formula C7H7I3
and a molecular weight of 471.85 g/mol. Its IUPAC name is benzyl(diiodo)-λ3-iodane.
Molecular Properties
| Compound Name | benzyl(diiodo)-λ3-iodane |
| PubChem CID | 140643667 |
| Molecular Formula | C7H7I3 |
| Molecular Weight | 471.85 g/mol |
| Exact Mass | 471.77 |
| IUPAC Name | benzyl(diiodo)-λ3-iodane |
| SMILES | II(I)Cc1ccccc1 |
| InChI | InChI=1S/C7H7I3/c8-10(9)6-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | HTFAZQDXTUQSQM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.85 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze benzyl(diiodo)-λ3-iodane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(diiodo)-λ3-iodane?
The IUPAC name of benzyl(diiodo)-λ3-iodane (CID 140643667) is benzyl(diiodo)-λ3-iodane.
What is the SMILES notation for benzyl(diiodo)-λ3-iodane?
The canonical SMILES for benzyl(diiodo)-λ3-iodane is II(I)Cc1ccccc1.
What is the InChIKey of benzyl(diiodo)-λ3-iodane?
The InChIKey is HTFAZQDXTUQSQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7I3/c8-10(9)6-7-4-2-1-3-5-7/h1-5H,6H2.
What are the key properties of benzyl(diiodo)-λ3-iodane?
benzyl(diiodo)-λ3-iodane has a molecular weight of 471.85 g/mol, XLogP of 4.39, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(diiodo)-λ3-iodane is sourced from PubChem (CID 140643667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).