C19H21F3N2O3 — CID 140644516
benzyl N-[5-[3-hydroxy-4-(trifluoromethyl)-2-pyridinyl]pentan-2-yl]carbamate (PubChem CID 140644516) has the molecular formula C19H21F3N2O3 and a molecular weight of 382.38 g/mol. Its IUPAC name is benzyl N-[5-[3-hydroxy-4-(trifluoromethyl)-2-pyridinyl]pentan-2-yl]carbamate.
| Compound Name | benzyl N-[5-[3-hydroxy-4-(trifluoromethyl)-2-pyridinyl]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 140644516 |
| Molecular Formula | C19H21F3N2O3 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | benzyl N-[5-[3-hydroxy-4-(trifluoromethyl)-2-pyridinyl]pentan-2-yl]carbamate |
| SMILES | CC(CCCc1nccc(C(F)(F)F)c1O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H21F3N2O3/c1-13(24-18(26)27-12-14-7-3-2-4-8-14)6-5-9-16-17(25)15(10-11-23-16)19(20,21)22/h2-4,7-8,10-11,13,25H,5-6,9,12H2,1H3,(H,24,26) |
| InChIKey | CAUXWLKTKKFROZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |