C34H41ClN8O2 — CID 140644944
3-[N'-[4-[6-[2-amino-3-[4-[3-(dimethylamino)propyl]anilino]-3-oxopropyl]naphthalen-2-yl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide (PubChem CID 140644944) has the molecular formula C34H41ClN8O2 and a molecular weight of 629.21 g/mol. Its IUPAC name is 3-[N'-[4-[6-[2-amino-3-[4-[3-(dimethylamino)propyl]anilino]-3-oxopropyl]naphthalen-2-yl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3-[N'-[4-[6-[2-amino-3-[4-[3-(dimethylamino)propyl]anilino]-3-oxopropyl]naphthalen-2-yl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 140644944 |
| Molecular Formula | C34H41ClN8O2 |
| Molecular Weight | 629.21 g/mol |
| Exact Mass | 628.30 |
| IUPAC Name | 3-[N'-[4-[6-[2-amino-3-[4-[3-(dimethylamino)propyl]anilino]-3-oxopropyl]naphthalen-2-yl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
| SMILES | CN(C)CCCc1ccc(NC(=O)C(N)Cc2ccc3cc(CCCC/N=C(\N)c4ncc(Cl)nc4C(N)=O)ccc3c2)cc1 |
| InChI | InChI=1S/C34H41ClN8O2/c1-43(2)17-5-7-22-10-14-27(15-11-22)41-34(45)28(36)20-24-9-13-25-18-23(8-12-26(25)19-24)6-3-4-16-39-32(37)30-31(33(38)44)42-29(35)21-40-30/h8-15,18-19,21,28H,3-7,16-17,20,36H2,1-2H3,(H2,37,39)(H2,38,44)(H,41,45) |
| InChIKey | NPZOPWODWWTYQX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 165.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.21 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|