C12H20O3 — CID 140651359
(E)-1-(3,4-dihydroxycyclohexyl)-4-methylpent-1-en-3-one (PubChem CID 140651359) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (E)-1-(3,4-dihydroxycyclohexyl)-4-methylpent-1-en-3-one.
| Compound Name | (E)-1-(3,4-dihydroxycyclohexyl)-4-methylpent-1-en-3-one |
|---|---|
| PubChem CID | 140651359 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (E)-1-(3,4-dihydroxycyclohexyl)-4-methylpent-1-en-3-one |
| SMILES | CC(C)C(=O)/C=C/C1CCC(O)C(O)C1 |
| InChI | InChI=1S/C12H20O3/c1-8(2)10(13)5-3-9-4-6-11(14)12(15)7-9/h3,5,8-9,11-12,14-15H,4,6-7H2,1-2H3/b5-3+ |
| InChIKey | AHJOKAQMSJVVSD-HWKANZROSA-N |
| XLogP | 1.29 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|