C24H40F2N4O2 — CID 140651899
N-[4-[1-(3,4-difluorocyclohexanecarbonyl)piperidin-4-yl]butyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,2-c]pyridine-2-carboxamide (PubChem CID 140651899) has the molecular formula C24H40F2N4O2 and a molecular weight of 454.61 g/mol. Its IUPAC name is N-[4-[1-(3,4-difluorocyclohexanecarbonyl)piperidin-4-yl]butyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,2-c]pyridine-2-carboxamide.
| Compound Name | N-[4-[1-(3,4-difluorocyclohexanecarbonyl)piperidin-4-yl]butyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 140651899 |
| Molecular Formula | C24H40F2N4O2 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | N-[4-[1-(3,4-difluorocyclohexanecarbonyl)piperidin-4-yl]butyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,2-c]pyridine-2-carboxamide |
| SMILES | O=C(NCCCCC1CCN(C(=O)C2CCC(F)C(F)C2)CC1)C1CC2CNCCC2N1 |
| InChI | InChI=1S/C24H40F2N4O2/c25-19-5-4-17(13-20(19)26)24(32)30-11-7-16(8-12-30)3-1-2-9-28-23(31)22-14-18-15-27-10-6-21(18)29-22/h16-22,27,29H,1-15H2,(H,28,31) |
| InChIKey | GAKFTOFSZIPKOM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|