C22H28N2O3 — CID 140653067
2-[(R)-cyclopropyl-[4-(hydroxycarbamoyl)phenyl]methyl]adamantane-1-carboxamide (PubChem CID 140653067) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 2-[(R)-cyclopropyl-[4-(hydroxycarbamoyl)phenyl]methyl]adamantane-1-carboxamide.
| Compound Name | 2-[(R)-cyclopropyl-[4-(hydroxycarbamoyl)phenyl]methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 140653067 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 2-[(R)-cyclopropyl-[4-(hydroxycarbamoyl)phenyl]methyl]adamantane-1-carboxamide |
| SMILES | NC(=O)C12CC3CC(CC(C3)C1[C@H](c1ccc(C(=O)NO)cc1)C1CC1)C2 |
| InChI | InChI=1S/C22H28N2O3/c23-21(26)22-10-12-7-13(11-22)9-17(8-12)19(22)18(14-1-2-14)15-3-5-16(6-4-15)20(25)24-27/h3-6,12-14,17-19,27H,1-2,7-11H2,(H2,23,26)(H,24,25)/t12?,13?,17?,18-,19?,22?/m0/s1 |
| InChIKey | NJQYSJDZJVDIJQ-DESGXLRFSA-N |
| XLogP | 3.23 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|