C25H28N2O3 — CID 87384200
N-[(R)-[4-(hydroxycarbamoyl)phenyl]-phenylmethyl]adamantane-1-carboxamide (PubChem CID 87384200) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is N-[(R)-[4-(hydroxycarbamoyl)phenyl]-phenylmethyl]adamantane-1-carboxamide.
| Compound Name | N-[(R)-[4-(hydroxycarbamoyl)phenyl]-phenylmethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 87384200 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | N-[(R)-[4-(hydroxycarbamoyl)phenyl]-phenylmethyl]adamantane-1-carboxamide |
| SMILES | O=C(NO)c1ccc([C@H](NC(=O)C23CC4CC(CC(C4)C2)C3)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H28N2O3/c28-23(27-30)21-8-6-20(7-9-21)22(19-4-2-1-3-5-19)26-24(29)25-13-16-10-17(14-25)12-18(11-16)15-25/h1-9,16-18,22,30H,10-15H2,(H,26,29)(H,27,28)/t16?,17?,18?,22-,25?/m1/s1 |
| InChIKey | QZRASLSBWBFMOC-DRQCUQGNSA-N |
| XLogP | 4.23 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|