C21H30N2O4 — CID 158933616
N-[1-[2-hydroxy-4-(hydroxycarbamoyl)phenyl]ethyl]adamantane-1-carboxamide;methane (PubChem CID 158933616) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is N-[1-[2-hydroxy-4-(hydroxycarbamoyl)phenyl]ethyl]adamantane-1-carboxamide;methane.
| Compound Name | N-[1-[2-hydroxy-4-(hydroxycarbamoyl)phenyl]ethyl]adamantane-1-carboxamide;methane |
|---|---|
| PubChem CID | 158933616 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | N-[1-[2-hydroxy-4-(hydroxycarbamoyl)phenyl]ethyl]adamantane-1-carboxamide;methane |
| SMILES | C.CC(NC(=O)C12CC3CC(CC(C3)C1)C2)c1ccc(C(=O)NO)cc1O |
| InChI | InChI=1S/C20H26N2O4.CH4/c1-11(16-3-2-15(7-17(16)23)18(24)22-26)21-19(25)20-8-12-4-13(9-20)6-14(5-12)10-20;/h2-3,7,11-14,23,26H,4-6,8-10H2,1H3,(H,21,25)(H,22,24);1H4 |
| InChIKey | JJJJHQWUXKMRSF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|