C12H21N2O2S+ — CID 140653692
tert-butyl 2-methylsulfanyl-8-aza-3-azoniabicyclo[3.2.1]oct-2-ene-8-carboxylate (PubChem CID 140653692) has the molecular formula C12H21N2O2S+ and a molecular weight of 257.38 g/mol. Its IUPAC name is tert-butyl 2-methylsulfanyl-8-aza-3-azoniabicyclo[3.2.1]oct-2-ene-8-carboxylate.
| Compound Name | tert-butyl 2-methylsulfanyl-8-aza-3-azoniabicyclo[3.2.1]oct-2-ene-8-carboxylate |
|---|---|
| PubChem CID | 140653692 |
| Molecular Formula | C12H21N2O2S+ |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | tert-butyl 2-methylsulfanyl-8-aza-3-azoniabicyclo[3.2.1]oct-2-ene-8-carboxylate |
| SMILES | CSC1=[NH+]CC2CCC1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H20N2O2S/c1-12(2,3)16-11(15)14-8-5-6-9(14)10(17-4)13-7-8/h8-9H,5-7H2,1-4H3/p+1 |
| InChIKey | AHOCGNBWTKJLIR-UHFFFAOYSA-O |
| XLogP | 0.61 |
| TPSA | 43.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |