C38H26Cl2F2N2Ni — CID 140654262
1,2-bis(4-fluorophenyl)-N,N'-bis(2-phenylphenyl)ethane-1,2-diimine;dichloronickel (PubChem CID 140654262) has the molecular formula C38H26Cl2F2N2Ni and a molecular weight of 678.24 g/mol. Its IUPAC name is 1,2-bis(4-fluorophenyl)-N,N'-bis(2-phenylphenyl)ethane-1,2-diimine;dichloronickel.
| Compound Name | 1,2-bis(4-fluorophenyl)-N,N'-bis(2-phenylphenyl)ethane-1,2-diimine;dichloronickel |
|---|---|
| PubChem CID | 140654262 |
| Molecular Formula | C38H26Cl2F2N2Ni |
| Molecular Weight | 678.24 g/mol |
| Exact Mass | 676.08 |
| IUPAC Name | 1,2-bis(4-fluorophenyl)-N,N'-bis(2-phenylphenyl)ethane-1,2-diimine;dichloronickel |
| SMILES | Cl[Ni]Cl.Fc1ccc(C(=N\c2ccccc2-c2ccccc2)/C(=N/c2ccccc2-c2ccccc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C38H26F2N2.2ClH.Ni/c39-31-23-19-29(20-24-31)37(41-35-17-9-7-15-33(35)27-11-3-1-4-12-27)38(30-21-25-32(40)26-22-30)42-36-18-10-8-16-34(36)28-13-5-2-6-14-28;;;/h1-26H;2*1H;/q;;;+2/p-2/b41-37+,42-38+;;; |
| InChIKey | ACFGRWXUGZQAOO-XMSVOTGESA-L |
| XLogP | 11.62 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.24 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|