C12H24BN3O4 — CID 140658602
(4S,5S)-2-(butylamino)-4-N,4-N,5-N,5-N-tetramethyl-1,3,2-dioxaborolane-4,5-dicarboxamide (PubChem CID 140658602) has the molecular formula C12H24BN3O4 and a molecular weight of 285.15 g/mol. Its IUPAC name is (4S,5S)-2-(butylamino)-4-N,4-N,5-N,5-N-tetramethyl-1,3,2-dioxaborolane-4,5-dicarboxamide.
| Compound Name | (4S,5S)-2-(butylamino)-4-N,4-N,5-N,5-N-tetramethyl-1,3,2-dioxaborolane-4,5-dicarboxamide |
|---|---|
| PubChem CID | 140658602 |
| Molecular Formula | C12H24BN3O4 |
| Molecular Weight | 285.15 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | (4S,5S)-2-(butylamino)-4-N,4-N,5-N,5-N-tetramethyl-1,3,2-dioxaborolane-4,5-dicarboxamide |
| SMILES | CCCCNB1O[C@H](C(=O)N(C)C)[C@@H](C(=O)N(C)C)O1 |
| InChI | InChI=1S/C12H24BN3O4/c1-6-7-8-14-13-19-9(11(17)15(2)3)10(20-13)12(18)16(4)5/h9-10,14H,6-8H2,1-5H3/t9-,10-/m0/s1 |
| InChIKey | XIWBFAKXRYHDGH-UWVGGRQHSA-N |
| XLogP | -0.68 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.15 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|