C15H25NO4 — CID 140659008
methyl (2S)-2-[(3S)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopenten-1-yl]propanoate (PubChem CID 140659008) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is methyl (2S)-2-[(3S)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopenten-1-yl]propanoate.
| Compound Name | methyl (2S)-2-[(3S)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopenten-1-yl]propanoate |
|---|---|
| PubChem CID | 140659008 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | methyl (2S)-2-[(3S)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopenten-1-yl]propanoate |
| SMILES | COC(=O)[C@@H](C)C1=C(C)[C@@H](NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H25NO4/c1-9-11(10(2)13(17)19-6)7-8-12(9)16-14(18)20-15(3,4)5/h10,12H,7-8H2,1-6H3,(H,16,18)/t10-,12-/m0/s1 |
| InChIKey | ZOAOQOPVZCFASX-JQWIXIFHSA-N |
| XLogP | 2.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|