C19H45NO4Si4 — CID 140660564
(E)-2-methyl-4-tris[[ethyl(dimethyl)silyl]oxy]silylhex-2-enamide (PubChem CID 140660564) has the molecular formula C19H45NO4Si4 and a molecular weight of 463.92 g/mol. Its IUPAC name is (E)-2-methyl-4-tris[[ethyl(dimethyl)silyl]oxy]silylhex-2-enamide.
| Compound Name | (E)-2-methyl-4-tris[[ethyl(dimethyl)silyl]oxy]silylhex-2-enamide |
|---|---|
| PubChem CID | 140660564 |
| Molecular Formula | C19H45NO4Si4 |
| Molecular Weight | 463.92 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | (E)-2-methyl-4-tris[[ethyl(dimethyl)silyl]oxy]silylhex-2-enamide |
| SMILES | CCC(/C=C(\C)C(N)=O)[Si](O[Si](C)(C)CC)(O[Si](C)(C)CC)O[Si](C)(C)CC |
| InChI | InChI=1S/C19H45NO4Si4/c1-12-18(16-17(5)19(20)21)28(22-25(6,7)13-2,23-26(8,9)14-3)24-27(10,11)15-4/h16,18H,12-15H2,1-11H3,(H2,20,21)/b17-16+ |
| InChIKey | MSFFTFDHFZHYOU-WUKNDPDISA-N |
| XLogP | 5.86 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.92 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|