C15H21N3O3 — CID 140667975
5-[(E)-3-[2-(dimethylamino)cyclohexyl]prop-2-enylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 140667975) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 5-[(E)-3-[2-(dimethylamino)cyclohexyl]prop-2-enylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(E)-3-[2-(dimethylamino)cyclohexyl]prop-2-enylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 140667975 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 5-[(E)-3-[2-(dimethylamino)cyclohexyl]prop-2-enylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CN(C)C1CCCCC1/C=C/C=C1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C15H21N3O3/c1-18(2)12-9-4-3-6-10(12)7-5-8-11-13(19)16-15(21)17-14(11)20/h5,7-8,10,12H,3-4,6,9H2,1-2H3,(H2,16,17,19,20,21)/b7-5+ |
| InChIKey | UDMYQEDWBIUPJS-FNORWQNLSA-N |
| XLogP | 0.96 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|