C12H10N2O3 — CID 89063839
5-[(E)-3-cyclopenta-1,3-dien-1-ylprop-2-enylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 89063839) has the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. Its IUPAC name is 5-[(E)-3-cyclopenta-1,3-dien-1-ylprop-2-enylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(E)-3-cyclopenta-1,3-dien-1-ylprop-2-enylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 89063839 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 5-[(E)-3-cyclopenta-1,3-dien-1-ylprop-2-enylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(=C/C=C/C2=CC=CC2)C(=O)N1 |
| InChI | InChI=1S/C12H10N2O3/c15-10-9(11(16)14-12(17)13-10)7-3-6-8-4-1-2-5-8/h1-4,6-7H,5H2,(H2,13,14,15,16,17)/b6-3+ |
| InChIKey | LCJDIXIXNUOYED-ZZXKWVIFSA-N |
| XLogP | 0.72 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|