C15H8F17NO2 — CID 140674444
3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,11,11,11-heptadecafluoroundecyl)pyrrole-2,5-dione (PubChem CID 140674444) has the molecular formula C15H8F17NO2 and a molecular weight of 557.20 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,11,11,11-heptadecafluoroundecyl)pyrrole-2,5-dione.
| Compound Name | 3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,11,11,11-heptadecafluoroundecyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 140674444 |
| Molecular Formula | C15H8F17NO2 |
| Molecular Weight | 557.20 g/mol |
| Exact Mass | 557.03 |
| IUPAC Name | 3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,11,11,11-heptadecafluoroundecyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCC(F)(F)F)C(=O)N1 |
| InChI | InChI=1S/C15H8F17NO2/c16-8(17,2-1-3-9(18,19)20)11(23,24)13(27,28)15(31,32)14(29,30)12(25,26)10(21,22)5-4-6(34)33-7(5)35/h4H,1-3H2,(H,33,34,35) |
| InChIKey | WCDPLLJGHLFJIQ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.20 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|