C10H6F9NO2 — CID 172640415
3-(1,1,2,2,3,3,6,6,6-nonafluorohexyl)pyrrole-2,5-dione (PubChem CID 172640415) has the molecular formula C10H6F9NO2 and a molecular weight of 343.15 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,6,6,6-nonafluorohexyl)pyrrole-2,5-dione.
| Compound Name | 3-(1,1,2,2,3,3,6,6,6-nonafluorohexyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 172640415 |
| Molecular Formula | C10H6F9NO2 |
| Molecular Weight | 343.15 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 3-(1,1,2,2,3,3,6,6,6-nonafluorohexyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(C(F)(F)C(F)(F)C(F)(F)CCC(F)(F)F)C(=O)N1 |
| InChI | InChI=1S/C10H6F9NO2/c11-7(12,1-2-8(13,14)15)10(18,19)9(16,17)4-3-5(21)20-6(4)22/h3H,1-2H2,(H,20,21,22) |
| InChIKey | WCKCERAPWTYABI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.15 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|