C17H18O3 — CID 140674802
(1S,5R)-4-[2-(3,4-dihydroxyphenyl)ethenyl]-6,6-dimethylbicyclo[3.1.1]hept-3-en-2-one (PubChem CID 140674802) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is (1S,5R)-4-[2-(3,4-dihydroxyphenyl)ethenyl]-6,6-dimethylbicyclo[3.1.1]hept-3-en-2-one.
| Compound Name | (1S,5R)-4-[2-(3,4-dihydroxyphenyl)ethenyl]-6,6-dimethylbicyclo[3.1.1]hept-3-en-2-one |
|---|---|
| PubChem CID | 140674802 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | (1S,5R)-4-[2-(3,4-dihydroxyphenyl)ethenyl]-6,6-dimethylbicyclo[3.1.1]hept-3-en-2-one |
| SMILES | CC1(C)[C@@H]2C[C@H]1C(C=Cc1ccc(O)c(O)c1)=CC2=O |
| InChI | InChI=1S/C17H18O3/c1-17(2)12-9-13(17)15(19)8-11(12)5-3-10-4-6-14(18)16(20)7-10/h3-8,12-13,18,20H,9H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | YNGFLSBWLRHNBO-QWHCGFSZSA-N |
| XLogP | 3.28 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|