C14H14N2O2S — CID 14067620
ethyl 6-ethylimidazo[2,1-b][1,3]benzothiazole-2-carboxylate (PubChem CID 14067620) has the molecular formula C14H14N2O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is ethyl 6-ethylimidazo[2,1-b][1,3]benzothiazole-2-carboxylate.
| Compound Name | ethyl 6-ethylimidazo[2,1-b][1,3]benzothiazole-2-carboxylate |
|---|---|
| PubChem CID | 14067620 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | ethyl 6-ethylimidazo[2,1-b][1,3]benzothiazole-2-carboxylate |
| SMILES | CCOC(=O)c1cn2c(n1)sc1cc(CC)ccc12 |
| InChI | InChI=1S/C14H14N2O2S/c1-3-9-5-6-11-12(7-9)19-14-15-10(8-16(11)14)13(17)18-4-2/h5-8H,3-4H2,1-2H3 |
| InChIKey | BFDKOXYWMALANU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |