C13H18FIN2O — CID 140678130
[3-fluoro-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)-3-bicyclo[3.1.0]hexanyl]methanol (PubChem CID 140678130) has the molecular formula C13H18FIN2O and a molecular weight of 364.20 g/mol. Its IUPAC name is [3-fluoro-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)-3-bicyclo[3.1.0]hexanyl]methanol.
| Compound Name | [3-fluoro-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)-3-bicyclo[3.1.0]hexanyl]methanol |
|---|---|
| PubChem CID | 140678130 |
| Molecular Formula | C13H18FIN2O |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | [3-fluoro-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)-3-bicyclo[3.1.0]hexanyl]methanol |
| SMILES | CC(C)n1nc(I)cc1C1C2CC(F)(CO)CC21 |
| InChI | InChI=1S/C13H18FIN2O/c1-7(2)17-10(3-11(15)16-17)12-8-4-13(14,6-18)5-9(8)12/h3,7-9,12,18H,4-6H2,1-2H3 |
| InChIKey | JYWIUBKIAMSFIT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|