C29H31N3O8S — CID 140682571
N-(1,3-benzothiazol-2-yl)-2-[6,6-dimethoxy-3-[3-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]cyclohexa-2,4-dien-1-yl]oxyacetamide (PubChem CID 140682571) has the molecular formula C29H31N3O8S and a molecular weight of 581.65 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-[6,6-dimethoxy-3-[3-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]cyclohexa-2,4-dien-1-yl]oxyacetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-[6,6-dimethoxy-3-[3-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]cyclohexa-2,4-dien-1-yl]oxyacetamide |
|---|---|
| PubChem CID | 140682571 |
| Molecular Formula | C29H31N3O8S |
| Molecular Weight | 581.65 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-[6,6-dimethoxy-3-[3-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]cyclohexa-2,4-dien-1-yl]oxyacetamide |
| SMILES | COc1cc(C2=NOC(C3=CC(OCC(=O)Nc4nc5ccccc5s4)C(OC)(OC)C=C3)C2)cc(OC)c1OC |
| InChI | InChI=1S/C29H31N3O8S/c1-34-22-12-18(13-23(35-2)27(22)36-3)20-15-21(40-32-20)17-10-11-29(37-4,38-5)25(14-17)39-16-26(33)31-28-30-19-8-6-7-9-24(19)41-28/h6-14,21,25H,15-16H2,1-5H3,(H,30,31,33) |
| InChIKey | XLDIRHSJEHWIOT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 118.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.65 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|