C19H29F2NSn — CID 140689230
tributyl-(2,6-difluoro-4-isocyanophenyl)stannane (PubChem CID 140689230) has the molecular formula C19H29F2NSn and a molecular weight of 428.16 g/mol. Its IUPAC name is tributyl-(2,6-difluoro-4-isocyanophenyl)stannane.
| Compound Name | tributyl-(2,6-difluoro-4-isocyanophenyl)stannane |
|---|---|
| PubChem CID | 140689230 |
| Molecular Formula | C19H29F2NSn |
| Molecular Weight | 428.16 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | tributyl-(2,6-difluoro-4-isocyanophenyl)stannane |
| SMILES | [C-]#[N+]c1cc(F)c([Sn](CCCC)(CCCC)CCCC)c(F)c1 |
| InChI | InChI=1S/C7H2F2N.3C4H9.Sn/c1-10-7-3-5(8)2-6(9)4-7;3*1-3-4-2;/h3-4H;3*1,3-4H2,2H3; |
| InChIKey | SEVGBQBCNIPCRA-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.16 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|