C19H32F2OSn — CID 177422057
tributyl-(2,6-difluoro-3-methoxyphenyl)stannane (PubChem CID 177422057) has the molecular formula C19H32F2OSn and a molecular weight of 433.17 g/mol. Its IUPAC name is tributyl-(2,6-difluoro-3-methoxyphenyl)stannane.
| Compound Name | tributyl-(2,6-difluoro-3-methoxyphenyl)stannane |
|---|---|
| PubChem CID | 177422057 |
| Molecular Formula | C19H32F2OSn |
| Molecular Weight | 433.17 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | tributyl-(2,6-difluoro-3-methoxyphenyl)stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1c(F)ccc(OC)c1F |
| InChI | InChI=1S/C7H5F2O.3C4H9.Sn/c1-10-7-3-2-5(8)4-6(7)9;3*1-3-4-2;/h2-3H,1H3;3*1,3-4H2,2H3; |
| InChIKey | FULDOVGYZMEBAI-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.17 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |