C18H27Cl2F3Sn — CID 86204959
tributyl-(3,5-dichloro-2,4,6-trifluorophenyl)stannane (PubChem CID 86204959) has the molecular formula C18H27Cl2F3Sn and a molecular weight of 490.03 g/mol. Its IUPAC name is tributyl-(3,5-dichloro-2,4,6-trifluorophenyl)stannane.
| Compound Name | tributyl-(3,5-dichloro-2,4,6-trifluorophenyl)stannane |
|---|---|
| PubChem CID | 86204959 |
| Molecular Formula | C18H27Cl2F3Sn |
| Molecular Weight | 490.03 g/mol |
| Exact Mass | 490.05 |
| IUPAC Name | tributyl-(3,5-dichloro-2,4,6-trifluorophenyl)stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1c(F)c(Cl)c(F)c(Cl)c1F |
| InChI | InChI=1S/C6Cl2F3.3C4H9.Sn/c7-4-2(9)1-3(10)5(8)6(4)11;3*1-3-4-2;/h;3*1,3-4H2,2H3; |
| InChIKey | WCMYQNCOSIVIPZ-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.03 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|