C12H23NaO5S — CID 140695310
sodium (E)-1,9-dihydroxy-5,9-dimethyldec-4-ene-1-sulfonate (PubChem CID 140695310) has the molecular formula C12H23NaO5S and a molecular weight of 302.37 g/mol. Its IUPAC name is sodium (E)-1,9-dihydroxy-5,9-dimethyldec-4-ene-1-sulfonate.
| Compound Name | sodium (E)-1,9-dihydroxy-5,9-dimethyldec-4-ene-1-sulfonate |
|---|---|
| PubChem CID | 140695310 |
| Molecular Formula | C12H23NaO5S |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | sodium (E)-1,9-dihydroxy-5,9-dimethyldec-4-ene-1-sulfonate |
| SMILES | C/C(=C\CCC(O)S(=O)(=O)[O-])CCCC(C)(C)O.[Na+] |
| InChI | InChI=1S/C12H24O5S.Na/c1-10(7-5-9-12(2,3)14)6-4-8-11(13)18(15,16)17;/h6,11,13-14H,4-5,7-9H2,1-3H3,(H,15,16,17);/q;+1/p-1/b10-6+; |
| InChIKey | JAHZFMGJDWWSNJ-AAGWESIMSA-M |
| XLogP | -1.48 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|