C18H29NO4 — CID 140702571
2-[[5-(decoxymethyl)furan-2-yl]methylideneamino]acetic acid (PubChem CID 140702571) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is 2-[[5-(decoxymethyl)furan-2-yl]methylideneamino]acetic acid.
| Compound Name | 2-[[5-(decoxymethyl)furan-2-yl]methylideneamino]acetic acid |
|---|---|
| PubChem CID | 140702571 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 2-[[5-(decoxymethyl)furan-2-yl]methylideneamino]acetic acid |
| SMILES | CCCCCCCCCCOCc1ccc(/C=N/CC(=O)O)o1 |
| InChI | InChI=1S/C18H29NO4/c1-2-3-4-5-6-7-8-9-12-22-15-17-11-10-16(23-17)13-19-14-18(20)21/h10-11,13H,2-9,12,14-15H2,1H3,(H,20,21)/b19-13+ |
| InChIKey | LBTCFUGSXIDOND-CPNJWEJPSA-N |
| XLogP | 4.44 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|