About 2-[[5-(decoxymethyl)furan-2-yl]methyl]-3-oxopropanoic acid;methanol
2-[[5-(decoxymethyl)furan-2-yl]methyl]-3-oxopropanoic acid;methanol (PubChem CID 168891159) has the molecular formula C20H34O6
and a molecular weight of 370.49 g/mol. Its IUPAC name is 2-[[5-(decoxymethyl)furan-2-yl]methyl]-3-oxopropanoic acid;methanol.
Molecular Properties
| Compound Name | 2-[[5-(decoxymethyl)furan-2-yl]methyl]-3-oxopropanoic acid;methanol |
| PubChem CID | 168891159 |
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 2-[[5-(decoxymethyl)furan-2-yl]methyl]-3-oxopropanoic acid;methanol |
| SMILES | CCCCCCCCCCOCc1ccc(CC(C=O)C(=O)O)o1.CO |
| InChI | InChI=1S/C19H30O5.CH4O/c1-2-3-4-5-6-7-8-9-12-23-15-18-11-10-17(24-18)13-16(14-20)19(21)22;1-2/h10-11,14,16H,2-9,12-13,15H2,1H3,(H,21,22);2H,1H3 |
| InChIKey | VYTAQGIKAWDHCF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-[[5-(decoxymethyl)furan-2-yl]methyl]-3-oxopropanoic acid;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(decoxymethyl)furan-2-yl]methyl]-3-oxopropanoic acid;methanol?
The IUPAC name of 2-[[5-(decoxymethyl)furan-2-yl]methyl]-3-oxopropanoic acid;methanol (CID 168891159) is 2-[[5-(decoxymethyl)furan-2-yl]methyl]-3-oxopropanoic acid;methanol.
What is the SMILES notation for 2-[[5-(decoxymethyl)furan-2-yl]methyl]-3-oxopropanoic acid;methanol?
The canonical SMILES for 2-[[5-(decoxymethyl)furan-2-yl]methyl]-3-oxopropanoic acid;methanol is CCCCCCCCCCOCc1ccc(CC(C=O)C(=O)O)o1.CO.
What is the InChIKey of 2-[[5-(decoxymethyl)furan-2-yl]methyl]-3-oxopropanoic acid;methanol?
The InChIKey is VYTAQGIKAWDHCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O5.CH4O/c1-2-3-4-5-6-7-8-9-12-23-15-18-11-10-17(24-18)13-16(14-20)19(21)22;1-2/h10-11,14,16H,2-9,12-13,15H2,1H3,(H,21,22);2H,1H3.
What are the key properties of 2-[[5-(decoxymethyl)furan-2-yl]methyl]-3-oxopropanoic acid;methanol?
2-[[5-(decoxymethyl)furan-2-yl]methyl]-3-oxopropanoic acid;methanol has a molecular weight of 370.49 g/mol, XLogP of 3.99, 15 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(decoxymethyl)furan-2-yl]methyl]-3-oxopropanoic acid;methanol is sourced from PubChem (CID 168891159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).