About deuterium monohydride;[5-(hexoxymethyl)furan-2-yl]methyl-trimethylazanium;iodide
deuterium monohydride;[5-(hexoxymethyl)furan-2-yl]methyl-trimethylazanium;iodide (PubChem CID 161053236) has the molecular formula C15H30INO2
and a molecular weight of 384.32 g/mol. Its IUPAC name is deuterium monohydride;[5-(hexoxymethyl)furan-2-yl]methyl-trimethylazanium;iodide.
Molecular Properties
| Compound Name | deuterium monohydride;[5-(hexoxymethyl)furan-2-yl]methyl-trimethylazanium;iodide |
| PubChem CID | 161053236 |
| Molecular Formula | C15H30INO2 |
| Molecular Weight | 384.32 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | deuterium monohydride;[5-(hexoxymethyl)furan-2-yl]methyl-trimethylazanium;iodide |
| SMILES | CCCCCCOCc1ccc(C[N+](C)(C)C)o1.[H][2H].[I-] |
| InChI | InChI=1S/C15H28NO2.HI.H2/c1-5-6-7-8-11-17-13-15-10-9-14(18-15)12-16(2,3)4;;/h9-10H,5-8,11-13H2,1-4H3;2*1H/q+1;;/p-1/i;;1+1 |
| InChIKey | GROVRPSMQCGZLD-FCHARDOESA-M |
| XLogP | 0.83 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze deuterium monohydride;[5-(hexoxymethyl)furan-2-yl]methyl-trimethylazanium;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuterium monohydride;[5-(hexoxymethyl)furan-2-yl]methyl-trimethylazanium;iodide?
The IUPAC name of deuterium monohydride;[5-(hexoxymethyl)furan-2-yl]methyl-trimethylazanium;iodide (CID 161053236) is deuterium monohydride;[5-(hexoxymethyl)furan-2-yl]methyl-trimethylazanium;iodide.
What is the SMILES notation for deuterium monohydride;[5-(hexoxymethyl)furan-2-yl]methyl-trimethylazanium;iodide?
The canonical SMILES for deuterium monohydride;[5-(hexoxymethyl)furan-2-yl]methyl-trimethylazanium;iodide is CCCCCCOCc1ccc(C[N+](C)(C)C)o1.[H][2H].[I-].
What is the InChIKey of deuterium monohydride;[5-(hexoxymethyl)furan-2-yl]methyl-trimethylazanium;iodide?
The InChIKey is GROVRPSMQCGZLD-FCHARDOESA-M. The full InChI is InChI=1S/C15H28NO2.HI.H2/c1-5-6-7-8-11-17-13-15-10-9-14(18-15)12-16(2,3)4;;/h9-10H,5-8,11-13H2,1-4H3;2*1H/q+1;;/p-1/i;;1+1.
What are the key properties of deuterium monohydride;[5-(hexoxymethyl)furan-2-yl]methyl-trimethylazanium;iodide?
deuterium monohydride;[5-(hexoxymethyl)furan-2-yl]methyl-trimethylazanium;iodide has a molecular weight of 384.32 g/mol, XLogP of 0.83, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for deuterium monohydride;[5-(hexoxymethyl)furan-2-yl]methyl-trimethylazanium;iodide is sourced from PubChem (CID 161053236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).