C19H30O6 — CID 168891155
2-[[5-(decoxymethyl)furan-2-yl]methyl]propanedioic acid (PubChem CID 168891155) has the molecular formula C19H30O6 and a molecular weight of 354.44 g/mol. Its IUPAC name is 2-[[5-(decoxymethyl)furan-2-yl]methyl]propanedioic acid.
| Compound Name | 2-[[5-(decoxymethyl)furan-2-yl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 168891155 |
| Molecular Formula | C19H30O6 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 2-[[5-(decoxymethyl)furan-2-yl]methyl]propanedioic acid |
| SMILES | CCCCCCCCCCOCc1ccc(CC(C(=O)O)C(=O)O)o1 |
| InChI | InChI=1S/C19H30O6/c1-2-3-4-5-6-7-8-9-12-24-14-16-11-10-15(25-16)13-17(18(20)21)19(22)23/h10-11,17H,2-9,12-14H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | IDTMVJSSIBGCSD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|