C18H20N+ — CID 140708374
8-deuterio-4-methyl-5-(2-methylphenyl)-4-azoniatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 140708374) has the molecular formula C18H20N+ and a molecular weight of 251.37 g/mol. Its IUPAC name is 8-deuterio-4-methyl-5-(2-methylphenyl)-4-azoniatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | 8-deuterio-4-methyl-5-(2-methylphenyl)-4-azoniatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 140708374 |
| Molecular Formula | C18H20N+ |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 8-deuterio-4-methyl-5-(2-methylphenyl)-4-azoniatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | [2H]C12CCC(C1)c1c[n+](C)c(-c3ccccc3C)cc12 |
| InChI | InChI=1S/C18H20N/c1-12-5-3-4-6-15(12)18-10-16-13-7-8-14(9-13)17(16)11-19(18)2/h3-6,10-11,13-14H,7-9H2,1-2H3/q+1/i13D |
| InChIKey | LYGSCFQPFSVSTK-YSOHJTORSA-N |
| XLogP | 3.85 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|