C27H33O5S- — CID 140708478
4-(4-tert-butylbenzoyl)oxy-2,6-dicyclopentylbenzenesulfonate (PubChem CID 140708478) has the molecular formula C27H33O5S- and a molecular weight of 469.62 g/mol. Its IUPAC name is 4-(4-tert-butylbenzoyl)oxy-2,6-dicyclopentylbenzenesulfonate.
| Compound Name | 4-(4-tert-butylbenzoyl)oxy-2,6-dicyclopentylbenzenesulfonate |
|---|---|
| PubChem CID | 140708478 |
| Molecular Formula | C27H33O5S- |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 4-(4-tert-butylbenzoyl)oxy-2,6-dicyclopentylbenzenesulfonate |
| SMILES | CC(C)(C)c1ccc(C(=O)Oc2cc(C3CCCC3)c(S(=O)(=O)[O-])c(C3CCCC3)c2)cc1 |
| InChI | InChI=1S/C27H34O5S/c1-27(2,3)21-14-12-20(13-15-21)26(28)32-22-16-23(18-8-4-5-9-18)25(33(29,30)31)24(17-22)19-10-6-7-11-19/h12-19H,4-11H2,1-3H3,(H,29,30,31)/p-1 |
| InChIKey | YSFWRRRBXPYABA-UHFFFAOYSA-M |
| XLogP | 6.42 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|