C28H35F4O5S- — CID 176603443
2,3,5,6-tetrafluoro-4-[2,4,6-tris(2-methylbutan-2-yl)benzoyl]oxybenzenesulfonate (PubChem CID 176603443) has the molecular formula C28H35F4O5S- and a molecular weight of 559.64 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[2,4,6-tris(2-methylbutan-2-yl)benzoyl]oxybenzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(2-methylbutan-2-yl)benzoyl]oxybenzenesulfonate |
|---|---|
| PubChem CID | 176603443 |
| Molecular Formula | C28H35F4O5S- |
| Molecular Weight | 559.64 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(2-methylbutan-2-yl)benzoyl]oxybenzenesulfonate |
| SMILES | CCC(C)(C)c1cc(C(C)(C)CC)c(C(=O)Oc2c(F)c(F)c(S(=O)(=O)[O-])c(F)c2F)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C28H36F4O5S/c1-10-26(4,5)15-13-16(27(6,7)11-2)18(17(14-15)28(8,9)12-3)25(33)37-23-19(29)21(31)24(38(34,35)36)22(32)20(23)30/h13-14H,10-12H2,1-9H3,(H,34,35,36)/p-1 |
| InChIKey | FNOHUWYVGKTGNK-UHFFFAOYSA-M |
| XLogP | 7.43 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.64 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|