C14H15ClF3NOS2 — CID 140709438
1-[2-chloro-5-(trifluoromethyl)phenyl]sulfanyl-1-(2,3-dihydro-1,2-thiazol-5-yl)butan-1-ol (PubChem CID 140709438) has the molecular formula C14H15ClF3NOS2 and a molecular weight of 369.86 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]sulfanyl-1-(2,3-dihydro-1,2-thiazol-5-yl)butan-1-ol.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]sulfanyl-1-(2,3-dihydro-1,2-thiazol-5-yl)butan-1-ol |
|---|---|
| PubChem CID | 140709438 |
| Molecular Formula | C14H15ClF3NOS2 |
| Molecular Weight | 369.86 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]sulfanyl-1-(2,3-dihydro-1,2-thiazol-5-yl)butan-1-ol |
| SMILES | CCCC(O)(Sc1cc(C(F)(F)F)ccc1Cl)C1=CCNS1 |
| InChI | InChI=1S/C14H15ClF3NOS2/c1-2-6-13(20,12-5-7-19-22-12)21-11-8-9(14(16,17)18)3-4-10(11)15/h3-5,8,19-20H,2,6-7H2,1H3 |
| InChIKey | KCQMKECLANGOLC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.86 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|