C36H58N4Pt — CID 140709864
(2S,4R,14R,16S,19R)-2,3,7,8,12,13,17,18-octaethyl-1,2,3,4,5,6,9,10,11,14,15,16,19,20-tetradecahydroporphyrin-21,22,23,24-tetraide;platinum(4+) (PubChem CID 140709864) has the molecular formula C36H58N4Pt and a molecular weight of 741.97 g/mol. Its IUPAC name is (2S,4R,14R,16S,19R)-2,3,7,8,12,13,17,18-octaethyl-1,2,3,4,5,6,9,10,11,14,15,16,19,20-tetradecahydroporphyrin-21,22,23,24-tetraide;platinum(4+).
| Compound Name | (2S,4R,14R,16S,19R)-2,3,7,8,12,13,17,18-octaethyl-1,2,3,4,5,6,9,10,11,14,15,16,19,20-tetradecahydroporphyrin-21,22,23,24-tetraide;platinum(4+) |
|---|---|
| PubChem CID | 140709864 |
| Molecular Formula | C36H58N4Pt |
| Molecular Weight | 741.97 g/mol |
| Exact Mass | 741.43 |
| IUPAC Name | (2S,4R,14R,16S,19R)-2,3,7,8,12,13,17,18-octaethyl-1,2,3,4,5,6,9,10,11,14,15,16,19,20-tetradecahydroporphyrin-21,22,23,24-tetraide;platinum(4+) |
| SMILES | CCC1=C(CC)C2C[C@H]3[N-]C(C[C@H]4[N-][C@@H](C[C@H]5[N-]C(CC1[N-]2)C(CC)=C5CC)C(CC)=C4CC)[C@@H](CC)C3CC.[Pt+4] |
| InChI | InChI=1S/C36H58N4.Pt/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30;/h21-22,29-36H,9-20H2,1-8H3;/q-4;+4/t21-,22?,29?,30+,31+,32?,33-,34?,35+,36?;/m0./s1 |
| InChIKey | PKXRNFHWAOXRRM-VAZYBGQHSA-N |
| XLogP | 10.46 |
| TPSA | 56.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.97 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|