C8H2BrFN2S — CID 140726547
2-bromo-4-fluoro-6-isocyano-1,3-benzothiazole (PubChem CID 140726547) has the molecular formula C8H2BrFN2S and a molecular weight of 257.09 g/mol. Its IUPAC name is 2-bromo-4-fluoro-6-isocyano-1,3-benzothiazole.
| Compound Name | 2-bromo-4-fluoro-6-isocyano-1,3-benzothiazole |
|---|---|
| PubChem CID | 140726547 |
| Molecular Formula | C8H2BrFN2S |
| Molecular Weight | 257.09 g/mol |
| Exact Mass | 255.91 |
| IUPAC Name | 2-bromo-4-fluoro-6-isocyano-1,3-benzothiazole |
| SMILES | [C-]#[N+]c1cc(F)c2nc(Br)sc2c1 |
| InChI | InChI=1S/C8H2BrFN2S/c1-11-4-2-5(10)7-6(3-4)13-8(9)12-7/h2-3H |
| InChIKey | GXDHRAAMIKOLOD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 17.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.09 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|